| Status: | ISO 1750 (published) |
|---|---|
| IUPAC PIN: | rac-(2R)-2-[4-(4-chlorophenoxy)phenoxy]propanoic acid |
| IUPAC name: | (2RS)-2-[4-(4-chlorophenoxy)phenoxy]propanoic acid 1979 Rules: (2RS)-2-[4-(4-chlorophenoxy)phenoxy]propionic acid |
| CAS name: | 2-[4-(4-chlorophenoxy)phenoxy]propanoic acid |
| CAS Reg. No.: | 26129-32-8 |
| Formula: | C15H13ClO4 |
| Activity: | herbicides (aryloxyphenoxypropionic) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example clofop-isobutyl [51337-71-4]. |
| Structure: |  |
| Pronunciation: | klō-fǒp Guide to British pronunciation |
| InChIKey: | BSFAVVHPEZCASB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H13ClO4/c1-10(15(17)18)19-12-6-8-14(9-7-12)20-13-4-2-11(16)3-5-13/h2-10H,1H3,(H,17,18) |