| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-2-methylpropyl (2R)-2-[4-(4-chlorophenoxy)phenoxy]propanoate |
| IUPAC name: | 2-methylpropyl (2RS)-2-[4-(4-chlorophenoxy)phenoxy]propanoate 1979 Rules: isobutyl (2RS)-2-[4-(4-chlorophenoxy)phenoxy]propionate |
| CAS name: | 2-methylpropyl 2-[4-(4-chlorophenoxy)phenoxy]propanoate |
| CAS Reg. No.: | 51337-71-4 |
| Formula: | C19H21ClO4 |
| Activity: | herbicides (aryloxyphenoxypropionic) |
| Notes: | This substance is a derivative of clofop [26129-32-8]. |
| Structure: | |
| Pronunciation: | klō-fǒp ī-sō-bū-tīl Guide to British pronunciation |
| InChIKey: | XNBRPBFBBCFVEH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C19H21ClO4/c1-13(2)12-22-19(21)14(3)23-16-8-10-18(11-9-16)24-17-6-4-15(20)5-7-17/h4-11,13-14H,12H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names