Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2,6-dibromo-4-cyanophenyl octanoate |
IUPAC name: | 2,6-dibromo-4-cyanophenyl octanoate |
CAS name: | 2,6-dibromo-4-cyanophenyl octanoate |
CAS Reg. No.: | 1689-99-2 |
Formula: | C15H17Br2NO2 |
Activity: | herbicides (hydroxybenzonitrile) |
Notes: | This substance is a derivative of bromoxynil [1689-84-5]. |
Structure: | |
Pronunciation: | brō-mǒks-ǐ-nǐl ǒk-tǎn-ō-āt Guide to British pronunciation |
InChIKey: | DQKWXTIYGWPGOO-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H17Br2NO2/c1-2-3-4-5-6-7-14(19)20-15-12(16)8-11(10-18)9-13(15)17/h8-9H,2-7H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names