| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | potassium 2,6-dibromo-4-cyanophenolate |
| IUPAC name: | potassium 2,6-dibromo-4-cyanophenolate |
| CAS name: | 3,5-dibromo-4-hydroxybenzonitrile potassium salt |
| CAS Reg. No.: | 2961-68-4 |
| Formula: | C7H2Br2KNO |
| Activity: | herbicides (hydroxybenzonitrile) |
| Notes: | This substance is a derivative of bromoxynil [1689-84-5]. |
| Structure: | |
| Pronunciation: | brō-mǒks-ǐ-nǐl pa-tǎs-ē-am Guide to British pronunciation |
| InChIKey: | HKSBGIRAPYUOPP-UHFFFAOYSA-M |
| InChI: | InChI=1S/C7H3Br2NO.K/c8-5-1-4(3-10)2-6(9)7(5)11;/h1-2,11H;/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names