| Approval: | Parent – ISO | 
|---|---|
| IUPAC PIN: | (2Ξ)-2-ethylhexyl (2R)-2-(2,4-dichlorophenoxy)propanoate | 
| IUPAC name: | (2RS)-2-ethylhexyl (2R)-2-(2,4-dichlorophenoxy)propionate | 
| CAS name: | 2-ethylhexyl (2R)-2-(2,4-dichlorophenoxy)propanoate | 
| CAS Reg. No.: | 865363-39-9 | 
| Formula: | C17H24Cl2O3 | 
| Activity: | herbicides (phenoxypropionic) plant growth regulators (auxin)  | 
| Notes: | This substance is a derivative of dichlorprop-P [15165-67-0]. This substance was previously known as dichlorprop-P-2-ethylhexyl. The unresolved racemic mixture of this substance has the ISO common name dichlorprop-etexyl [79270-78-3].  | 
| Structure: | |
| Pronunciation: | dī-klor-prǒp pē ē-těks-īl Guide to British pronunciation | 
| InChIKey: | CEEDFYRUPAWDOU-PZORYLMUSA-N | 
| InChI: | InChI=1S/C17H24Cl2O3/c1-4-6-7-13(5-2)11-21-17(20)12(3)22-16-9-8-14(18)10-15(16)19/h8-10,12-13H,4-7,11H2,1-3H3/t12-,13?/m1/s1 | 
A data sheet from the Compendium of Pesticide Common Names