| Approval: | ISO |
|---|---|
| IUPAC PIN: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid |
| IUPAC name: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid 1979 Rules: (R)-2-(2,4-dichlorophenoxy)propionic acid |
| CAS name: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid |
| CAS Reg. No.: | 15165-67-0 |
| Formula: | C9H8Cl2O3 |
| Activity: | herbicides (phenoxypropionic) |
| Notes: | Derivatives include dichlorprop-P-dimethylammonium [104786-87-0], dichlorprop-P-etexyl [865363-39-9], dichlorprop-P-potassium [113963-87-4], dichlorprop-P-sodium [119299-10-4]. The unresolved racemic mixture of this substance has the common name dichlorprop [120-36-5]. |
| Structure: |  |
| Pronunciation: | dī-klor-prǒp pē Guide to British pronunciation |
| InChIKey: | MZHCENGPTKEIGP-RXMQYKEDSA-N |
| InChI: | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/t5-/m1/s1 |