Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | methyl 9-hydroxy-9H-fluorene-9-carboxylate |
IUPAC name: | methyl 9-hydroxyfluorene-9-carboxylate |
CAS name: | methyl 9-hydroxy-9H-fluorene-9-carboxylate |
CAS Reg. No.: | 1216-44-0 |
Formula: | C15H12O3 |
Activity: | plant growth regulators (morphactin) |
Notes: | This substance is a derivative of flurenol [467-69-6]. The name “flurecol-methyl” is used in Canada, Denmark and the USA. |
Structure: | |
Pronunciation: | flūr-ē-nǒl mē-thīl Guide to British pronunciation |
InChIKey: | AJKQZRAAQMBNKM-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H12O3/c1-18-14(16)15(17)12-8-4-2-6-10(12)11-7-3-5-9-13(11)15/h2-9,17H,1H3 |
A data sheet from the Compendium of Pesticide Common Names