| Status: | ISO 1750 (published) |
|---|---|
| IUPAC PIN: | 9-hydroxy-9H-fluorene-9-carboxylic acid |
| IUPAC name: | 9-hydroxyfluorene-9-carboxylic acid |
| CAS name: | 9-hydroxy-9H-fluorene-9-carboxylic acid |
| CAS Reg. No.: | 467-69-6 |
| Formula: | C14H10O3 |
| Activity: | plant growth regulators (morphactin) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example flurenol-butyl [2314-09-2], flurenol-methyl [1216-44-0]. The name “flurecol” is used in Canada, Denmark and the USA, and was formerly approved by the British Standards Institution. The name “芴丁酯” is approved in China for flurenol and for flurenol-butyl. |
| Structure: |  |
| Pronunciation: | flūr-ē-nǒl Guide to British pronunciation |
| InChIKey: | GXAMYUGOODKVRM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H10O3/c15-13(16)14(17)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,17H,(H,15,16) |