Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | acetic acid—N,N‴-[azanediyldi(octane-8,1-diyl)]diguanidine (3/1) |
IUPAC name: | 1,1′-(iminodioctamethylene)diguanidine—acetic acid (1/3) or bis(8-guanidinooctyl)amine—acetic acid (1/3) |
CAS name: | N,N‴-(iminodi-8,1-octanediyl)bis[guanidine] triacetate |
CAS Reg. No.: | 57520-17-9 |
Formula: | C24H53N7O6 |
Activity: | fungicides (guanidine) |
Notes: | This substance is a derivative of iminoctadine [13516-27-3]. |
Structure: | |
Pronunciation: | ǐm-ǐn-ǒk-ta-dēn trī-ǎs-ǐ-tāt Guide to British pronunciation |
InChIKey: | FKWDSATZSMJRLC-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H41N7.3C2H4O2/c19-17(20)24-15-11-7-3-1-5-9-13-23-14-10-6-2-4-8-12-16-25-18(21)22;3*1-2(3)4/h23H,1-16H2,(H4,19,20,24)(H4,21,22,25);3*1H3,(H,3,4) |
A data sheet from the Compendium of Pesticide Common Names