Approval: | ISO |
---|---|
IUPAC PIN: | N,N‴-[azanediyldi(octane-8,1-diyl)]diguanidine |
IUPAC name: | 1,1′-(iminodioctamethylene)diguanidine or bis(8-guanidinooctyl)amine |
CAS name: | N,N‴-(iminodi-8,1-octanediyl)bis[guanidine] |
CAS Reg. No.: | 13516-27-3 |
Formula: | C18H41N7 |
Activity: | fungicides (guanidine) |
Notes: | Derivatives include iminoctadine triacetate [57520-17-9], iminoctadine trialbesilate [169202-06-6]. The ISO common name guazatine [108173-90-6] was originally given to this substance, but the definition of guazatine was later changed when it became known that the commercial substance was a complex reaction product containing this as well as several other active compounds. |
Structure: | |
Pronunciation: | ǐm-ǐn-ǒk-ta-dēn Guide to British pronunciation |
InChIKey: | RONFGUROBZGJKP-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H41N7/c19-17(20)24-15-11-7-3-1-5-9-13-23-14-10-6-2-4-8-12-16-25-18(21)22/h23H,1-16H2,(H4,19,20,24)(H4,21,22,25) |
A data sheet from the Compendium of Pesticide Common Names