Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-butoxyethyl (4-chloro-2-methylphenoxy)acetate |
IUPAC name: | 2-butoxyethyl [(4-chloro-o-tolyl)oxy]acetate |
CAS name: | 2-butoxyethyl 2-(4-chloro-2-methylphenoxy)acetate |
CAS Reg. No.: | 19480-43-4 |
Formula: | C15H21ClO4 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of MCPA [94-74-6]. |
Structure: | |
Pronunciation: | ěm sē pē ā bū-tō-tīl Guide to British pronunciation |
InChIKey: | WKGKFWXGAHXMCE-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H21ClO4/c1-3-4-7-18-8-9-19-15(17)11-20-14-6-5-13(16)10-12(14)2/h5-6,10H,3-4,7-9,11H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names