Approval: | ISO |
---|---|
IUPAC PIN: | (4-chloro-2-methylphenoxy)acetic acid |
IUPAC name: | (4-chloro-2-methylphenoxy)acetic acid 1979 Rules: [(4-chloro-o-tolyl)oxy]acetic acid |
CAS name: | 2-(4-chloro-2-methylphenoxy)acetic acid |
CAS Reg. No.: | 94-74-6 |
Formula: | C9H9ClO3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | * The name 2,4-MCPA (n.m.) is also used in France. The names “metaxon” (метаксон) and “2M-4C” (2М-4Х) were used in the former USSR. Derivatives include MCPA-butotyl [19480-43-4], MCPA-butyl [1713-12-8], MCPA-dimethylammonium [2039-46-5], MCPA-diolamine [20405-19-0], MCPA-etexyl [29450-45-1], MCPA-ethyl [2698-38-6], MCPA-isobutyl [1713-11-7], MCPA-isoctyl [26544-20-7], MCPA-isopropyl [2698-40-0], MCPA-methyl [2436-73-9], MCPA-olamine [6365-62-4], MCPA-potassium [5221-16-9], MCPA-sodium [3653-48-3], MCPA-trolamine [42459-68-7]. |
Structure: | |
Pronunciation: | ěm sē pē ā Guide to British pronunciation |
InChIKey: | WHKUVVPPKQRRBV-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H9ClO3/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names