| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | sodium 2-(naphthalen-1-ylcarbamoyl)benzoate |
| IUPAC name: | sodium N-1-naphthylphthalamate |
| CAS name: | 2-[(1-naphthalenylamino)carbonyl]benzoic acid monosodium salt |
| CAS Reg. No.: | 132-67-2 |
| Formula: | C18H12NNaO3 |
| Activity: | herbicides (arylcarboxylic acid) |
| Notes: | This substance is a derivative of naptalam [132-66-1]. The name “NPA” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | nǎp-ta-lǎm sō-dē-am Guide to British pronunciation |
| InChIKey: | CLHHSSXFXYAXDB-UHFFFAOYSA-M |
| InChI: | InChI=1S/C18H13NO3.Na/c20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16;/h1-11H,(H,19,20)(H,21,22);/q;+1/p-1 |