| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2-(naphthalen-1-ylcarbamoyl)benzoic acid |
| IUPAC name: | N-1-naphthylphthalamic acid |
| CAS name: | 2-[(1-naphthalenylamino)carbonyl]benzoic acid |
| CAS Reg. No.: | 132-66-1 |
| Formula: | C18H13NO3 |
| Activity: | herbicides (arylcarboxylic acid) |
| Notes: | Derivatives include naptalam-sodium [132-67-2], for which the common name “NPA” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. The name “alanap” is used in Turkey, but Alanap is a registered trade mark in many countries. |
| Structure: |  |
| Pronunciation: | nǎp-ta-lǎm Guide to British pronunciation |
| InChIKey: | JXTHEWSKYLZVJC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H13NO3/c20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16/h1-11H,(H,19,20)(H,21,22) |