| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | sodium 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)sulfanyl]benzoate |
| IUPAC name: | sodium 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)thio]benzoate |
| CAS name: | sodium 2-chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]benzoate |
| CAS Reg. No.: | 123343-16-8 |
| Formula: | C13H10ClN2NaO4S |
| Activity: | herbicides (pyrimidinyl benzoate herbicides) |
| Notes: | This substance is a derivative of pyrithiobac [123342-93-8]. |
| Structure: | |
| Pronunciation: | pǐ-rǐ-thī-ō-bǎk sō-dē-am Guide to British pronunciation |
| InChIKey: | CNILNQMBAHKMFS-UHFFFAOYSA-M |
| InChI: | InChI=1S/C13H11ClN2O4S.Na/c1-19-9-6-10(20-2)16-13(15-9)21-8-5-3-4-7(14)11(8)12(17)18;/h3-6H,1-2H3,(H,17,18);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names