Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)sulfanyl]benzoic acid |
IUPAC name: | 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)thio]benzoic acid |
CAS name: | 2-chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]benzoic acid |
CAS Reg. No.: | 123342-93-8 |
Formula: | C13H11ClN2O4S |
Activity: | herbicides (pyrimidinyl benzoate) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example pyrithiobac-sodium [123343-16-8]. |
Structure: | |
Pronunciation: | pǐ-rǐ-thī-ō-bǎk Guide to British pronunciation |
InChIKey: | QEGVVEOAVNHRAA-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H11ClN2O4S/c1-19-9-6-10(20-2)16-13(15-9)21-8-5-3-4-7(14)11(8)12(17)18/h3-6H,1-2H3,(H,17,18) |
A data sheet from the Compendium of Pesticide Common Names