Approval: | ISO |
---|---|
IUPAC PIN: | dimethyl (1,2-phenylenedicarbamothioyl)dicarbamate |
IUPAC name: | dimethyl (1,2-phenylenedicarbamothioyl)dicarbamate 1979 Rules: dimethyl 4,4′-(o-phenylene)bis(3-thioallophanate) |
CAS name: | dimethyl N,N′-[1,2-phenylenebis(iminocarbonothioyl)]bis[carbamate] |
CAS Reg. No.: | 23564-05-8 |
Formula: | C12H14N4O4S2 |
Activity: | fungicides (thiophanate) |
Notes: | The analogous diethyl ester has the ISO common name thiophanate [23564-06-9]. |
Structure: | |
Pronunciation: | thī-ǒf-an-āt mē-thīl Guide to British pronunciation |
InChIKey: | QGHREAKMXXNCOA-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H14N4O4S2/c1-19-11(17)15-9(21)13-7-5-3-4-6-8(7)14-10(22)16-12(18)20-2/h3-6H,1-2H3,(H2,13,15,17,21)(H2,14,16,18,22) |
A data sheet from the Compendium of Pesticide Common Names