| Approval: | ISO |
|---|---|
| IUPAC PIN: | diethyl (1,2-phenylenedicarbamothioyl)dicarbamate |
| IUPAC name: | diethyl (1,2-phenylenedicarbamothioyl)dicarbamate 1979 Rules: diethyl 4,4′-(o-phenylene)bis(3-thioallophanate) |
| CAS name: | diethyl N,N′-[1,2-phenylenebis(iminocarbonothioyl)]bis[carbamate] |
| CAS Reg. No.: | 23564-06-9 |
| Formula: | C14H18N4O4S2 |
| Activity: | fungicides (thiophanate) |
| Notes: | * The name “thiophanate-éthyl” (n.m.) is used in France. The analogous dimethyl ester has the ISO common name thiophanate-methyl [23564-05-8]. |
| Structure: |  |
| Pronunciation: | thī-ǒf-an-āt Guide to British pronunciation |
| InChIKey: | YFNCATAIYKQPOO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H18N4O4S2/c1-3-21-13(19)17-11(23)15-9-7-5-6-8-10(9)16-12(24)18-14(20)22-4-2/h5-8H,3-4H2,1-2H3,(H2,15,17,19,23)(H2,16,18,20,24) |