| Status: | ISO 765 (published) |
|---|---|
| IUPAC PIN: | pentachlorophenol |
| IUPAC name: | pentachlorophenol |
| CAS name: | 2,3,4,5,6-pentachlorophenol |
| CAS Reg. No.: | 87-86-5 |
| Formula: | C6HCl5O |
| Activity: | fungicides (phenol) herbicides (phenol) insecticides (phenol) molluscicides plant growth regulators (defoliant) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “PCP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries and the Weed Science Society of America, and is also approved in China (五氯酚). The sodium salt, the laurate ester and the methylmercury derivative are also considered by the International Organization for Standardization not to require a common name, see sodium pentachlorophenate [131-52-2], pentachlorophenyl laurate [3772-94-9] and methylmercury pentachlorophenoxide. |
| Structure: |  |
| Pronunciation: | pěn-ta-klor-ō-fē-nǒl Guide to British pronunciation |
| InChIKey: | IZUPBVBPLAPZRR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6HCl5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |